CAS 88300-06-5

4-Ethyl-2-methyl-5-propyloxazole

Description:

4-Ethyl-2-methyl-5-propyloxazole, identified by its CAS number 88300-06-5, is a heterocyclic organic compound featuring an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen atoms. This compound is characterized by its unique substitution pattern, which includes an ethyl group, a methyl group, and a propyloxy group attached to the oxazole ring. Such substitutions can influence its physical and chemical properties, including solubility, boiling point, and reactivity. Generally, oxazole derivatives are known for their potential biological activities, making them of interest in medicinal chemistry. The presence of the propyloxy group may enhance lipophilicity, potentially affecting the compound's interaction with biological membranes. Additionally, the structural features of 4-Ethyl-2-methyl-5-propyloxazole may contribute to its stability and reactivity under various conditions, although specific reactivity and stability data would require further investigation. Overall, this compound exemplifies the diversity of oxazole derivatives and their potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₁₅NO

InChI: InChI=1S/C9H15NO/c1-4-6-9-8(5-2)10-7(3)11-9/h4-6H2,1-3H3

InChI key: InChIKey=OJFZPFCEFJXLIK-UHFFFAOYSA-N

SMILES: C(CC)C1=C(CC)N=C(C)O1

Synonyms:

• 2-Methyl-4-ethyl-5-propyloxazole
• 4-Ethyl-2-methyl-5-propyloxazole
• Oxazole, 4-ethyl-2-methyl-5-propyl-

Oxazole, 4-ethyl-2-methyl-5-propyl-

CAS: 88300-06-5

Formula: C₉H₁₅NO

Molecular weight: 153.2215

Ref: IN-DA00499J