CAS 88300-07-6
:5-Butyl-2,4-dimethyloxazole
Description:
5-Butyl-2,4-dimethyloxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a butyl group and two methyl groups attached to the oxazole ring, contributing to its unique chemical properties. Typically, oxazoles exhibit moderate polarity due to the electronegative nitrogen and oxygen atoms, which can influence their solubility in various solvents. The presence of the butyl group enhances hydrophobic characteristics, potentially affecting the compound's interactions in biological systems or chemical reactions. 5-Butyl-2,4-dimethyloxazole may also exhibit interesting reactivity due to the presence of the double bond in the oxazole ring, making it a candidate for various synthetic applications. Its specific applications and behavior in chemical reactions would depend on the context of use, such as in pharmaceuticals, agrochemicals, or materials science. As with any chemical substance, safety data and handling precautions should be consulted before use.
Formula:C9H15NO
InChI:InChI=1S/C9H15NO/c1-4-5-6-9-7(2)10-8(3)11-9/h4-6H2,1-3H3
InChI key:InChIKey=IXECKEKKCJBKQJ-UHFFFAOYSA-N
SMILES:C(CCC)C=1OC(C)=NC1C
Synonyms:- Oxazole, 5-butyl-2,4-dimethyl-
- 5-Butyl-2,4-dimethyloxazole
- 2,4-Dimethyl-5-butyloxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
