CAS 883010-02-4

2-methoxy-N'-[4-(trifluoromethyl)pyridin-2-yl]benzohydrazide

Description:

2-Methoxy-N'-[4-(trifluoromethyl)pyridin-2-yl]benzohydrazide is a chemical compound characterized by its complex structure, which includes a methoxy group, a hydrazide functional group, and a pyridine ring substituted with a trifluoromethyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydrazide moiety, which can participate in various chemical reactions, including condensation and hydrazone formation. The trifluoromethyl group enhances the lipophilicity and may influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the methoxy group can affect the electronic properties and steric hindrance of the molecule, potentially impacting its interaction with biological targets. Overall, this compound's unique structural features suggest it may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₄H₁₂F₃N₃O₂

InChI: InChI=1/C14H12F3N3O2/c1-22-11-5-3-2-4-10(11)13(21)20-19-12-8-9(6-7-18-12)14(15,16)17/h2-8H,1H3,(H,18,19)(H,20,21)

SMILES: COc1ccccc1C(=NNc1cc(ccn1)C(F)(F)F)O