CymitQuimica logo

CAS 883010-07-9

:

3-methoxy-N'-[4-(trifluoromethyl)pyridin-2-yl]benzohydrazide

Description:
3-Methoxy-N'-[4-(trifluoromethyl)pyridin-2-yl]benzohydrazide is a chemical compound characterized by its complex structure, which includes a methoxy group, a hydrazide functional group, and a pyridine ring substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both hydrazides and aromatic systems, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially impacting its reactivity and solubility. The presence of multiple functional groups suggests that this compound may exhibit diverse chemical behavior, including potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species.
Formula:C14H12F3N3O2
InChI:InChI=1/C14H12F3N3O2/c1-22-11-4-2-3-9(7-11)13(21)20-19-12-8-10(5-6-18-12)14(15,16)17/h2-8H,1H3,(H,18,19)(H,20,21)
SMILES:COc1cccc(c1)C(=NNc1cc(ccn1)C(F)(F)F)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.