CymitQuimica logo

CAS 883010-17-1

:

3-(trifluoromethyl)-N'-[4-(trifluoromethyl)pyridin-2-yl]benzohydrazide

Description:
3-(Trifluoromethyl)-N'-[4-(trifluoromethyl)pyridin-2-yl]benzohydrazide is a chemical compound characterized by its complex structure, which includes a hydrazide functional group and multiple trifluoromethyl groups. The presence of these trifluoromethyl groups contributes to its unique electronic properties, enhancing its lipophilicity and potentially influencing its biological activity. The compound features a benzohydrazide backbone, which is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals. The pyridine ring in the structure adds to its aromatic character and may participate in various interactions, such as hydrogen bonding or π-π stacking, which can be crucial for its reactivity and binding properties. This compound may exhibit interesting pharmacological activities, making it a subject of interest in drug discovery and development. Its stability, solubility, and reactivity can be influenced by the presence of the trifluoromethyl groups, which are known to impart unique characteristics to organic molecules. Overall, this compound represents a valuable entity in the field of organic and medicinal chemistry.
Formula:C14H9F6N3O
InChI:InChI=1/C14H9F6N3O/c15-13(16,17)9-3-1-2-8(6-9)12(24)23-22-11-7-10(4-5-21-11)14(18,19)20/h1-7H,(H,21,22)(H,23,24)
SMILES:c1cc(cc(c1)C(F)(F)F)C(=NNc1cc(ccn1)C(F)(F)F)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.