CymitQuimica logo

CAS 883010-71-7

:

2-methyl-N'-[4-(trifluoromethyl)pyridin-2-yl]propanehydrazide

Description:
2-methyl-N'-[4-(trifluoromethyl)pyridin-2-yl]propanehydrazide is a chemical compound characterized by its hydrazide functional group, which is linked to a substituted pyridine ring. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The compound features a branched alkyl chain, specifically a 2-methyl group, which can affect its steric properties and reactivity. The pyridine moiety contributes to the compound's potential as a ligand in coordination chemistry or as a scaffold in medicinal chemistry, where it may exhibit various pharmacological activities. Additionally, the trifluoromethyl group is known to impart unique electronic properties, making the compound of interest in the development of agrochemicals or pharmaceuticals. Its molecular structure suggests potential applications in various fields, including materials science and drug development, although specific biological or chemical properties would require empirical investigation. As with any chemical substance, safety data and handling precautions should be considered due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C10H12F3N3O
InChI:InChI=1/C10H12F3N3O/c1-6(2)9(17)16-15-8-5-7(3-4-14-8)10(11,12)13/h3-6H,1-2H3,(H,14,15)(H,16,17)
SMILES:CC(C)C(=NNc1cc(ccn1)C(F)(F)F)O
Synonyms:
  • 2-methyl-N'-[4-(trifluoromethyl)-2-pyridinyl]propanohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.