CAS 883010-83-1

methyl 2-[4-(trifluoromethyl)pyridin-2-yl]hydrazinecarboxylate

Description:

Methyl 2-[4-(trifluoromethyl)pyridin-2-yl]hydrazinecarboxylate, with the CAS number 883010-83-1, is a chemical compound characterized by its unique structure, which includes a hydrazinecarboxylate moiety and a pyridine ring substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both hydrazine derivatives and pyridine-based compounds, such as potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions, including condensation and oxidation. The trifluoromethyl group enhances the lipophilicity and stability of the molecule, potentially influencing its biological activity and interaction with other substances. Methyl 2-[4-(trifluoromethyl)pyridin-2-yl]hydrazinecarboxylate may be of interest in medicinal chemistry and agrochemical applications due to its structural features, which could confer specific pharmacological properties. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with hydrazine derivatives.

Formula: C₈H₈F₃N₃O₂

InChI: InChI=1/C8H8F3N3O2/c1-16-7(15)14-13-6-4-5(2-3-12-6)8(9,10)11/h2-4H,1H3,(H,12,13)(H,14,15)

SMILES: COC(=NNc1cc(ccn1)C(F)(F)F)O

Synonyms:

• Methyl 2-[4-(Trifluoromethyl)Pyridin-2-Yl]Hydrazine-1-Carboxylate