CymitQuimica logo

CAS 883010-89-7

:

ethyl 2-[4-(trifluoromethyl)pyridin-2-yl]hydrazinecarboxylate

Description:
Ethyl 2-[4-(trifluoromethyl)pyridin-2-yl]hydrazinecarboxylate is a chemical compound characterized by its unique structure, which includes a hydrazinecarboxylate moiety and a pyridine ring substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both hydrazine derivatives and pyridine-based compounds, such as potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions, including condensation and oxidation. The trifluoromethyl group enhances the lipophilicity and may influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the ethyl ester component contributes to its solubility in organic solvents. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety and handling precautions should be observed due to the presence of the hydrazine group, which can be hazardous. Overall, this compound represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C9H10F3N3O2
InChI:InChI=1/C9H10F3N3O2/c1-2-17-8(16)15-14-7-5-6(3-4-13-7)9(10,11)12/h3-5H,2H2,1H3,(H,13,14)(H,15,16)
SMILES:CCOC(=NNc1cc(ccn1)C(F)(F)F)O
Synonyms:
  • Ethyl 2-[4-(Trifluoromethyl)Pyridin-2-Yl]Hydrazine-1-Carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.