CymitQuimica logo

CAS 88302-07-2

:

6-Ethyl-1,2-dihydro-2-oxo-5-(1-oxopropyl)-3-pyridinecarboxylic acid

Description:
6-Ethyl-1,2-dihydro-2-oxo-5-(1-oxopropyl)-3-pyridinecarboxylic acid, with the CAS number 88302-07-2, is a pyridine derivative characterized by its unique structural features, including a pyridine ring and multiple functional groups. This compound typically exhibits properties associated with carboxylic acids, such as acidity and the ability to form salts and esters. The presence of the ethyl and propyl substituents contributes to its hydrophobic characteristics, which may influence its solubility in various solvents. Additionally, the diketone functionality (2-oxo groups) can participate in various chemical reactions, including condensation and nucleophilic addition. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other reagents. Overall, 6-Ethyl-1,2-dihydro-2-oxo-5-(1-oxopropyl)-3-pyridinecarboxylic acid represents a complex organic molecule with diverse chemical properties and potential applications in various fields.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c1-3-8-6(9(13)4-2)5-7(11(15)16)10(14)12-8/h5H,3-4H2,1-2H3,(H,12,14)(H,15,16)
InChI key:InChIKey=YHDKUXJBSHEMTQ-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(CC)NC(=O)C(C(O)=O)=C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-ethyl-1,2-dihydro-2-oxo-5-(1-oxopropyl)-
  • 6-Ethyl-1,2-dihydro-2-oxo-5-(1-oxopropyl)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.