CAS 88310-62-7
:5-Chloro-2-hydroxy-3-nitrobenzonitrile
Description:
5-Chloro-2-hydroxy-3-nitrobenzonitrile, with the CAS number 88310-62-7, is an organic compound that belongs to the class of nitro-substituted benzonitriles. It features a benzene ring substituted with a chloro group, a hydroxyl group, and a nitro group, which contribute to its chemical reactivity and properties. The presence of the hydroxyl group indicates that it can participate in hydrogen bonding, potentially affecting its solubility in polar solvents. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the chloro substituent can also affect the electronic distribution within the molecule. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis and handling require standard safety precautions, as with many chemical substances, to mitigate any risks associated with its use.
Formula:C7H3ClN2O3
InChI:InChI=1S/C7H3ClN2O3/c8-5-1-4(3-9)7(11)6(2-5)10(12)13/h1-2,11H
InChI key:InChIKey=YPZASGUTWBNWFJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(O)C(C#N)=CC(Cl)=C1
Synonyms:- 5-Chloro-2-hydroxy-3-nitrobenzonitrile
- Benzonitrile, 5-chloro-2-hydroxy-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
