CAS 883106-35-2

Phenylmethyl 1H-1,2,4-triazole-1-acetate

Description:

Phenylmethyl 1H-1,2,4-triazole-1-acetate, identified by its CAS number 883106-35-2, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This substance typically exhibits characteristics such as being a white to off-white solid, with moderate solubility in organic solvents and limited solubility in water. Its structure features a phenylmethyl group attached to a triazole ring, which contributes to its potential biological activity. Compounds of this nature are often studied for their pharmacological properties, including antifungal and antibacterial activities. The presence of the acetate functional group may also influence its reactivity and interaction with biological targets. As with many triazole derivatives, it may act as a ligand in coordination chemistry or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c15-11(6-14-9-12-8-13-14)16-7-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2

InChI key: InChIKey=XNDXQSVWSKBZIM-UHFFFAOYSA-N

SMILES: C(C(OCC1=CC=CC=C1)=O)N2C=NC=N2

Synonyms:

• 1H-1,2,4-Triazole-1-acetic acid, phenylmethyl ester
• Phenylmethyl 1H-1,2,4-triazole-1-acetate

Benzyl 2-(1H-1,2,4-triazol-1-yl)acetate

CAS: 883106-35-2

Versatile small molecule scaffold

Formula: C₁₁H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 217.22 g/mol

Ref: 3D-IKB10635