CymitQuimica logo

CAS 883106-47-6

:

1-(cyclopropylcarbonyl)piperidin-4-amine

Description:
1-(Cyclopropylcarbonyl)piperidin-4-amine is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a cyclopropylcarbonyl group and an amine functional group. This compound typically exhibits properties associated with both cyclic amines and carbonyl compounds, such as potential basicity due to the amine and reactivity due to the carbonyl. The presence of the cyclopropyl group may influence its steric and electronic properties, potentially affecting its interactions in biological systems or chemical reactions. It is likely to be a solid at room temperature, with solubility in polar solvents, given the presence of the amine group. The compound may be of interest in medicinal chemistry for its potential pharmacological activities, as piperidine derivatives are often explored for various therapeutic applications. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C9H16N2O
InChI:InChI=1/C9H16N2O/c10-8-3-5-11(6-4-8)9(12)7-1-2-7/h7-8H,1-6,10H2
SMILES:C1CC1C(=O)N1CCC(CC1)N
Synonyms:
  • (4-Aminopiperidin-1-yl)(cyclopropyl)methanone
  • Methanone, (4-amino-1-piperidinyl)cyclopropyl-
  • 1-(Cyclopropylcarbonyl)piperidin-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.