CymitQuimica logo

CAS 883106-57-8

:

N-(4-Bromophenyl)-4-piperidinecarboxamide

Description:
N-(4-Bromophenyl)-4-piperidinecarboxamide, with the CAS number 883106-57-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which contributes to its unique chemical properties and potential biological activity. The carboxamide functional group enhances its solubility in polar solvents and can influence its interaction with biological targets. Typically, compounds like this may exhibit pharmacological properties, making them of interest in medicinal chemistry and drug development. The presence of the bromine atom can also affect the compound's reactivity and stability. Overall, N-(4-Bromophenyl)-4-piperidinecarboxamide is a synthetic organic molecule that may be studied for its potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H15BrN2O
InChI:InChI=1S/C12H15BrN2O/c13-10-1-3-11(4-2-10)15-12(16)9-5-7-14-8-6-9/h1-4,9,14H,5-8H2,(H,15,16)
InChI key:InChIKey=ZEIHWXAWUVDDRI-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Br)C=C1)(=O)C2CCNCC2
Synonyms:
  • 4-Piperidinecarboxamide, N-(4-bromophenyl)-
  • N-(4-Bromophenyl)-4-piperidinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.