CAS 883106-59-0
:N-(4-Nitrophenyl)-4-piperidinecarboxamide
Description:
N-(4-Nitrophenyl)-4-piperidinecarboxamide, with the CAS number 883106-59-0, is a chemical compound characterized by its piperidine structure, which is a six-membered ring containing one nitrogen atom. This compound features a nitrophenyl group, which contributes to its potential as a pharmacological agent due to the electron-withdrawing nature of the nitro group. The presence of the carboxamide functional group enhances its solubility and reactivity, making it suitable for various chemical reactions. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in drug synthesis or as active pharmaceutical ingredients. Its molecular structure suggests it may interact with biological targets, influencing processes such as enzyme activity or receptor binding. The compound's stability, solubility, and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. As with any chemical substance, proper handling and safety protocols should be observed due to potential toxicity or reactivity.
Formula:C12H15N3O3
InChI:InChI=1S/C12H15N3O3/c16-12(9-5-7-13-8-6-9)14-10-1-3-11(4-2-10)15(17)18/h1-4,9,13H,5-8H2,(H,14,16)
InChI key:InChIKey=JFBDQUQRCYWIMW-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(N(=O)=O)C=C1)(=O)C2CCNCC2
Synonyms:- 4-Piperidinecarboxamide, N-(4-nitrophenyl)-
- N-(4-Nitrophenyl)-4-piperidinecarboxamide
- PIPERIDINE-4-CARBOXYLIC ACID (4-NITRO-PHENYL)-AMIDE
- N-(4-Nitrophenyl)piperidine-4-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.