CAS 883106-75-0
:N-(5-Methyl-2-pyridinyl)-3-piperidinecarboxamide
Description:
N-(5-Methyl-2-pyridinyl)-3-piperidinecarboxamide, identified by its CAS number 883106-75-0, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a pyridine moiety, specifically a 5-methyl-2-pyridine group, which contributes to its aromatic properties. This compound is classified as an amide due to the presence of the carboxamide functional group, which is characterized by a carbonyl group (C=O) directly attached to a nitrogen atom (N). The presence of both the piperidine and pyridine rings suggests potential biological activity, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the functional groups present. Additionally, its synthesis and applications may be explored in various fields, including pharmaceuticals, where it could serve as a lead compound for drug development or as a tool in biochemical research.
Formula:C12H17N3O
InChI:InChI=1S/C12H17N3O/c1-9-4-5-11(14-7-9)15-12(16)10-3-2-6-13-8-10/h4-5,7,10,13H,2-3,6,8H2,1H3,(H,14,15,16)
InChI key:InChIKey=KWGBTPRTFMXLOD-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C)C=N1)(=O)C2CCCNC2
Synonyms:- 3-Piperidinecarboxamide, N-(5-methyl-2-pyridinyl)-
- N-(5-Methyl-2-pyridinyl)-3-piperidinecarboxamide
- PIPERIDINE-3-CARBOXYLIC ACID (5-METHYL-PYRIDIN-2-YL)-AMIDE
- N-(5-Methylpyridin-2-yl)piperidine-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
