
CAS 883107-42-4
:2,3,5,6-Tetraiodothieno[3,2-b]thiophene
Description:
2,3,5,6-Tetraiodothieno[3,2-b]thiophene is a polycyclic aromatic compound characterized by its unique structure, which includes a thieno[3,2-b]thiophene core substituted with four iodine atoms at the 2, 3, 5, and 6 positions. This compound exhibits notable electronic properties due to the presence of iodine, which can enhance its conductivity and stability. It is typically a solid at room temperature and may exhibit a range of colors depending on its crystalline form. The iodine substituents contribute to its high molecular weight and can influence its solubility in various solvents, often making it more soluble in organic solvents. Additionally, the compound may demonstrate interesting optical properties, making it a candidate for applications in organic electronics, such as organic photovoltaics and field-effect transistors. Its synthesis and characterization are of interest in materials science and organic chemistry, particularly in the development of novel electronic materials. Safety precautions should be taken when handling this compound due to the toxicity associated with iodine and potential environmental impacts.
Formula:C6I4S2
InChI:InChI=1S/C6I4S2/c7-1-3-4(12-5(1)9)2(8)6(10)11-3
InChI key:InChIKey=AGXPJITWRHKFFT-UHFFFAOYSA-N
SMILES:IC=1C2=C(C(I)=C(I)S2)SC1I
Synonyms:- 2,3,5,6-Tetraiodothieno[3,2-b]thiophene
- Thieno[3,2-b]thiophene, 2,3,5,6-tetraiodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
