CymitQuimica logo

CAS 883107-61-7

:

4-Chloro-2-(4-hydroxy-1-piperidinyl)-5-thiazolecarboxaldehyde

Description:
4-Chloro-2-(4-hydroxy-1-piperidinyl)-5-thiazolecarboxaldehyde is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a chloro group at the 4-position and a hydroxyl group at the 4-position of the piperidine moiety contributes to its reactivity and potential biological activity. This compound features an aldehyde functional group, which is known for its ability to participate in various chemical reactions, including condensation and oxidation. The thiazole and piperidine components suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as they may exhibit various biological activities. The compound's structure allows for interactions with biological targets, making it of interest in drug discovery. Additionally, its solubility and stability in different solvents can influence its behavior in biological systems and chemical reactions. Overall, 4-Chloro-2-(4-hydroxy-1-piperidinyl)-5-thiazolecarboxaldehyde is a compound with diverse potential applications in research and industry.
Formula:C9H11ClN2O2S
InChI:InChI=1S/C9H11ClN2O2S/c10-8-7(5-13)15-9(11-8)12-3-1-6(14)2-4-12/h5-6,14H,1-4H2
InChI key:InChIKey=QXAQQHPRPGAHJI-UHFFFAOYSA-N
SMILES:C(=O)C=1SC(=NC1Cl)N2CCC(O)CC2
Synonyms:
  • 4-Chloro-2-(4-hydroxy-1-piperidinyl)-5-thiazolecarboxaldehyde
  • 5-Thiazolecarboxaldehyde, 4-Chloro-2-(4-Hydroxy-1-Piperidinyl)-
  • 4-Chloro-2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.