CAS 883107-63-9

3-(2,4-Difluorophenyl)-2-propenal

Description:

3-(2,4-Difluorophenyl)-2-propenal, identified by its CAS number 883107-63-9, is an organic compound characterized by its unique structure, which includes a propenal functional group and a difluorophenyl substituent. This compound typically exhibits a yellow to light brown appearance and is known for its reactivity due to the presence of the α,β-unsaturated aldehyde moiety. The difluorophenyl group contributes to its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of fluorine atoms can influence the compound's polarity and solubility in various solvents. As an aldehyde, it can participate in various chemical reactions, including condensation and addition reactions. Its potential applications may span across fields such as organic synthesis, pharmaceuticals, and materials science, where it could serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any reactive organic compound.

Formula: C₉H₆F₂O

InChI: InChI=1S/C9H6F2O/c10-8-4-3-7(2-1-5-12)9(11)6-8/h1-6H

InChI key: InChIKey=XVVKESKJTRIKLY-UHFFFAOYSA-N

SMILES: C(=CC=O)C1=C(F)C=C(F)C=C1

Synonyms:

• 3-(2,4-Difluorophenyl)-2-propenal
• 2-Propenal, 3-(2,4-difluorophenyl)-
• 2,4-Difluorocinnamaldehyde
• 3-(2,4-difluorophenyl)prop-2-enal
• (E)-3-(2,4-difluorophenyl)acrylaldehyde