CAS 88312-65-6
:Ethyl 2-amino-5-nitro-3-pyridinecarboxylate
Description:
Ethyl 2-amino-5-nitro-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a nitro group (-NO2) attached to the pyridine ring, contributing to its reactivity and potential applications in pharmaceuticals and agrochemicals. The ethyl ester functional group (-COOEt) enhances its solubility in organic solvents, making it suitable for various chemical reactions. The presence of both the amino and nitro groups can influence the compound's biological activity, potentially allowing it to act as a precursor in the synthesis of more complex molecules. Additionally, the compound's molecular structure suggests it may exhibit polar characteristics, affecting its interactions in biological systems. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive and may pose health risks. Overall, Ethyl 2-amino-5-nitro-3-pyridinecarboxylate is a versatile compound with significant implications in chemical research and development.
Formula:C8H9N3O4
InChI:InChI=1S/C8H9N3O4/c1-2-15-8(12)6-3-5(11(13)14)4-10-7(6)9/h3-4H,2H2,1H3,(H2,9,10)
InChI key:InChIKey=IXVHWCFQORHXNA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C(N(=O)=O)C=NC1N
Synonyms:- Ethyl 2-amino-5-nitro-3-pyridinecarboxylate
- 2-Amino-5-nitro-nicotinic acid ethyl ester
- Nicotinic acid, 2-amino-5-nitro-, ethyl ester
- 3-Pyridinecarboxylic acid, 2-amino-5-nitro-, ethyl ester
- Ethyl 2-amino-5-nitronicotinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
