CAS 88312-67-8

Methanone, (2-amino-5-nitro-3-pyridinyl)-1-pyrrolidinyl-

Description:

Methanone, (2-amino-5-nitro-3-pyridinyl)-1-pyrrolidinyl- is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with an amino and nitro group, along with a pyrrolidine moiety. This compound is classified as an organic nitrogen compound and is notable for its potential biological activity, often studied in the context of medicinal chemistry. The presence of the nitro group may impart specific reactivity and influence the compound's pharmacological properties. Its molecular structure suggests it could interact with various biological targets, making it of interest in drug development. The compound's CAS number, 88312-67-8, serves as a unique identifier in chemical databases, facilitating research and regulatory processes. As with many nitrogen-containing heterocycles, it may exhibit diverse chemical behaviors, including potential for hydrogen bonding and participation in various chemical reactions. Safety and handling precautions are essential when working with such compounds, as they may possess toxicological risks or environmental impacts.

Formula: C₁₀H₁₂N₄O₃

InChI: InChI=1S/C10H12N4O3/c11-9-8(5-7(6-12-9)14(16)17)10(15)13-3-1-2-4-13/h5-6H,1-4H2,(H2,11,12)

InChI key: InChIKey=FEXPBDBGIDRDQA-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(N(=O)=O)C=NC1N)N2CCCC2

Synonyms:

• (2-Amino-5-nitropyridin-3-yl)-pyrrolidin-1-ylmethanone
• Pyrrolidine, 1-[(2-amino-5-nitro-3-pyridinyl)carbonyl]-
• Methanone, (2-amino-5-nitro-3-pyridinyl)-1-pyrrolidinyl-

Pyrrolidine, 1-[(2-amino-5-nitro-3-pyridinyl)carbonyl]-

CAS: 88312-67-8

Formula: C₁₀H₁₂N₄O₃

Molecular weight: 236.2273

Ref: IN-DA0048PJ