CAS 883146-12-1

4-(2,2-difluoro-1-methyl-ethyl)benzenesulfonyl chloride

Description:

4-(2,2-Difluoro-1-methyl-ethyl)benzenesulfonyl chloride, with the CAS number 883146-12-1, is a sulfonyl chloride compound characterized by the presence of a sulfonyl group (-SO2Cl) attached to a benzene ring that is further substituted with a difluoroalkyl group. This compound typically exhibits high reactivity due to the sulfonyl chloride functional group, making it useful in various chemical reactions, particularly in the synthesis of sulfonamides and other derivatives. The difluoroalkyl substituent contributes to its unique properties, including increased lipophilicity and potential biological activity. It is generally a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. Safety precautions are essential when handling this compound, as it can be corrosive and may release toxic gases upon hydrolysis. Its applications may span across pharmaceuticals, agrochemicals, and materials science, where it serves as an intermediate in the synthesis of more complex molecules.

Formula: C₉H₉ClF₂O₂S

InChI: InChI=1/C9H9ClF2O2S/c1-6(9(11)12)7-2-4-8(5-3-7)15(10,13)14/h2-6,9H,1H3

SMILES: CC(c1ccc(cc1)S(=O)(=O)Cl)C(F)F