CAS 88321-07-7

N-(1-Oxo-2-propylpentyl)glycine

Description:

N-(1-Oxo-2-propylpentyl)glycine, identified by its CAS number 88321-07-7, is an organic compound that features both an amine and a carboxylic acid functional group, characteristic of amino acids. This compound is likely to exhibit properties typical of amino acids, such as being soluble in water due to the presence of polar functional groups. The presence of the propyl and pentyl chains suggests that it may have hydrophobic characteristics, which could influence its solubility and interaction with biological membranes. The "1-Oxo" designation indicates the presence of a carbonyl group, which may contribute to its reactivity and potential applications in synthesis or as a biochemical agent. Additionally, the structure implies that it could participate in various chemical reactions, including peptide bond formation, making it relevant in the context of biochemistry and pharmaceuticals. Overall, N-(1-Oxo-2-propylpentyl)glycine may have unique properties that could be explored for various applications in medicinal chemistry and related fields.

Formula: C₁₀H₁₉NO₃

InChI: InChI=1S/C10H19NO3/c1-3-5-8(6-4-2)10(14)11-7-9(12)13/h8H,3-7H2,1-2H3,(H,11,14)(H,12,13)

InChI key: InChIKey=QBKXUUNBNHZZPK-UHFFFAOYSA-N

SMILES: C(C(NCC(O)=O)=O)(CCC)CCC

Synonyms:

• 2-(2-Propylpentanoylamino)acetic acid
• N-Valproylglycine
• KN 539
• Glycine, N-(1-oxo-2-propylpentyl)-
• N-(1-Oxo-2-propylpentyl)glycine