CAS 88321-12-4
:1-Propanol, 3-(trimethoxysilyl)-, carbonate (2:1)
Description:
1-Propanol, 3-(trimethoxysilyl)-, carbonate (2:1), with the CAS number 88321-12-4, is a chemical compound that features both silane and carbonate functional groups. This substance is characterized by its ability to act as a coupling agent, enhancing the adhesion between organic materials and inorganic substrates, which is particularly useful in coatings, sealants, and adhesives. The presence of the trimethoxysilyl group allows for chemical bonding to surfaces such as glass, metals, and ceramics, while the carbonate moiety contributes to its reactivity and potential applications in polymer chemistry. Typically, this compound is a colorless to pale yellow liquid with a moderate viscosity, and it is soluble in organic solvents. Its reactivity can be influenced by environmental factors such as moisture, which can lead to hydrolysis of the silane groups, forming silanol and releasing methanol. Overall, this compound is valued in various industrial applications for its multifunctional properties, combining silane chemistry with carbonate reactivity to improve material performance.
Formula:C13H30O9Si2
InChI:InChI=1S/C13H30O9Si2/c1-15-23(16-2,17-3)11-7-9-21-13(14)22-10-8-12-24(18-4,19-5)20-6/h7-12H2,1-6H3
InChI key:InChIKey=FQQGKCCEPLNZQK-UHFFFAOYSA-N
SMILES:[Si](CCCOC(OCCC[Si](OC)(OC)OC)=O)(OC)(OC)OC
Synonyms:- 1-Propanol, 3-(trimethoxysilyl)-, carbonate (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
