CymitQuimica logo

CAS 88327-72-4

:

2H-Pyrido[1,2-a]pyrazine, 2-ethyloctahydro-

Description:
2H-Pyrido[1,2-a]pyrazine, 2-ethyloctahydro- is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings, which contribute to its unique chemical properties. This compound features a saturated octahydro structure, indicating the presence of multiple hydrogen atoms and a degree of saturation that affects its reactivity and stability. The ethyl group attached to the structure enhances its hydrophobic characteristics, influencing its solubility in organic solvents. Generally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the ring structure can also impart basicity, allowing for potential interactions with various biological targets. Additionally, the compound's molecular geometry and electronic configuration can affect its physical properties, such as boiling and melting points, as well as its behavior in chemical reactions. Overall, 2H-Pyrido[1,2-a]pyrazine, 2-ethyloctahydro- represents a complex structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c1-2-11-7-8-12-6-4-3-5-10(12)9-11/h10H,2-9H2,1H3
InChI key:BPEYEJWZKDMFJE-UHFFFAOYSA-N
SMILES:CCN1CCN2CCCCC2C1
Found 1 products.