
CAS 883291-29-0
:4-(Methoxymethyl)-6-methylthieno[2,3-b]pyridine-2,3-diamine
Description:
4-(Methoxymethyl)-6-methylthieno[2,3-b]pyridine-2,3-diamine is a chemical compound characterized by its unique thieno[2,3-b]pyridine core structure, which incorporates both thieno and pyridine functionalities. This compound features a methoxymethyl group and two amino groups at the 2 and 3 positions of the pyridine ring, contributing to its potential reactivity and biological activity. The presence of the methyl group at the 6 position enhances its lipophilicity, which may influence its pharmacokinetic properties. The methoxymethyl substituent can also affect the compound's solubility and stability. As a member of the thieno-pyridine class, it may exhibit interesting properties, including potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its specific interactions and effects would depend on the molecular conformation and the presence of functional groups, making it a subject of interest for further research in drug design and synthesis.
Formula:C10H13N3OS
InChI:InChI=1S/C10H13N3OS/c1-5-3-6(4-14-2)7-8(11)9(12)15-10(7)13-5/h3H,4,11-12H2,1-2H3
InChI key:InChIKey=LWUHESJESOMEJZ-UHFFFAOYSA-N
SMILES:C(OC)C1=C2C(SC(N)=C2N)=NC(C)=C1
Synonyms:- Thieno[2,3-b]pyridine-2,3-diamine, 4-(methoxymethyl)-6-methyl-
- 4-(Methoxymethyl)-6-methylthieno[2,3-b]pyridine-2,3-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.