CAS 883291-43-8
:N-(2-Amino-4-ethoxyphenyl)-2-hydroxypropanamide
Description:
N-(2-Amino-4-ethoxyphenyl)-2-hydroxypropanamide, with the CAS number 883291-43-8, is an organic compound characterized by its amide functional group, which is linked to a hydroxypropanamide structure. This compound features an amino group and an ethoxy substituent on a phenyl ring, contributing to its potential biological activity. The presence of the hydroxy group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The ethoxy group can provide lipophilicity, which may affect the compound's pharmacokinetics and bioavailability. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C11H16N2O3
InChI:InChI=1S/C11H16N2O3/c1-3-16-8-4-5-10(9(12)6-8)13-11(15)7(2)14/h4-7,14H,3,12H2,1-2H3,(H,13,15)
InChI key:InChIKey=JYKZSBPQFAWFTQ-UHFFFAOYSA-N
SMILES:N(C(C(C)O)=O)C1=C(N)C=C(OCC)C=C1
Synonyms:- N-(2-Amino-4-ethoxyphenyl)-2-hydroxypropanamide
- Propanamide, N-(2-amino-4-ethoxyphenyl)-2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.