CAS 883291-48-3
:3-methoxy-5-(1H-tetrazol-1-yl)aniline
Description:
3-Methoxy-5-(1H-tetrazol-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a methoxy group and a tetrazole moiety. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its reactivity and biological activity. The tetrazole ring, a five-membered heterocyclic structure containing four nitrogen atoms, is known for its stability and is often involved in various pharmacological applications, including as a bioisostere for carboxylic acids. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, 3-methoxy-5-(1H-tetrazol-1-yl)aniline represents a versatile scaffold for further chemical modifications and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H9N5O
InChI:InChI=1/C8H9N5O/c1-14-8-3-6(9)2-7(4-8)13-5-10-11-12-13/h2-5H,9H2,1H3
SMILES:COc1cc(cc(c1)n1cnnn1)N
Synonyms:- benzenamine, 3-methoxy-5-(1H-tetrazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenamine, 3-methoxy-5-(1H-tetrazol-1-yl)-
CAS:Formula:C8H9N5OColor and Shape:SolidMolecular weight:191.1900
