
CAS 883291-49-4
:5-(2-Naphthalenyloxy)-1,3-benzenediamine
Description:
5-(2-Naphthalenyloxy)-1,3-benzenediamine, identified by its CAS number 883291-49-4, is an organic compound characterized by its complex aromatic structure. This substance features a naphthalene moiety linked via an ether bond to a benzene ring that is further substituted with two amine groups at the 1 and 3 positions. The presence of these functional groups suggests potential applications in various fields, including pharmaceuticals and materials science, due to their ability to participate in hydrogen bonding and other interactions. The compound is likely to exhibit moderate solubility in organic solvents, while its solid-state properties may include crystalline or amorphous forms depending on the synthesis method. Additionally, the presence of multiple aromatic rings may contribute to its stability and potential for electronic applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.
Formula:C16H14N2O
InChI:InChI=1S/C16H14N2O/c17-13-8-14(18)10-16(9-13)19-15-6-5-11-3-1-2-4-12(11)7-15/h1-10H,17-18H2
InChI key:InChIKey=ZGWQLHLHIXQPBA-UHFFFAOYSA-N
SMILES:O(C1=CC2=C(C=C1)C=CC=C2)C3=CC(N)=CC(N)=C3
Synonyms:- 5-(2-Naphthalenyloxy)-1,3-benzenediamine
- 1,3-Benzenediamine, 5-(2-naphthalenyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.