CAS 883291-52-9

2-[[3-Nitro-5-[(phenylmethyl)sulfonyl]phenyl]thio]acetic acid

Description:

2-[[3-Nitro-5-[(phenylmethyl)sulfonyl]phenyl]thio]acetic acid, identified by its CAS number 883291-52-9, is a synthetic organic compound characterized by its complex molecular structure. This substance features a thioether linkage, which contributes to its reactivity and potential biological activity. The presence of a nitro group and a sulfonyl group indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. The phenylmethyl group enhances its lipophilicity, potentially affecting its interaction with biological membranes. As an acetic acid derivative, it may exhibit acidic properties, which can be relevant in various chemical reactions. This compound is of interest in medicinal chemistry and may have applications in drug development due to its unique functional groups that can interact with biological targets. However, specific safety and handling information, as well as detailed biological activity, would require further investigation and should be referenced from appropriate safety data sheets and scientific literature.

Formula: C₁₅H₁₃NO₆S₂

InChI: InChI=1S/C15H13NO6S2/c17-15(18)9-23-13-6-12(16(19)20)7-14(8-13)24(21,22)10-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,17,18)

InChI key: InChIKey=DQGWGSMYTJFGLJ-UHFFFAOYSA-N

SMILES: S(CC1=CC=CC=C1)(=O)(=O)C2=CC(N(=O)=O)=CC(SCC(O)=O)=C2

Synonyms:

• 2-[[3-Nitro-5-[(phenylmethyl)sulfonyl]phenyl]thio]acetic acid
• Acetic acid, [[3-nitro-5-[(phenylmethyl)sulfonyl]phenyl]thio]-
• Acetic acid, 2-[[3-nitro-5-[(phenylmethyl)sulfonyl]phenyl]thio]-