CAS 88331-14-0
:L-tyrosyl-N~5~-(diaminomethylidene)-D-ornithyl-N-{[(2S)-1-(4-nitro-L-phenylalanyl)pyrrolidin-2-yl]carbonyl}glycinamide acetate (1:2)
Description:
L-tyrosyl-N~5~-(diaminomethylidene)-D-ornithyl-N-{[(2S)-1-(4-nitro-L-phenylalanyl)pyrrolidin-2-yl]carbonyl}glycinamide acetate is a complex organic compound characterized by its intricate structure, which includes multiple amino acid residues and functional groups. This substance features a combination of amino acids, including tyrosine and ornithine, linked through peptide bonds, and incorporates a nitrophenylalanine moiety that contributes to its potential biological activity. The presence of the diaminomethylidene group suggests reactivity that may be relevant in biochemical pathways or therapeutic applications. The acetate component indicates that the compound is likely to be soluble in polar solvents, enhancing its bioavailability. Its CAS number, 88331-14-0, allows for precise identification in chemical databases. Overall, this compound's unique structure may confer specific properties that could be explored in pharmacological research, particularly in the context of peptide synthesis and drug development.
Formula:C35H50N10O12
InChI:InChI=1/C31H42N10O8.2C2H4O2/c32-22(15-19-7-11-21(42)12-8-19)27(44)38-24(3-1-13-36-31(34)35)28(45)37-17-26(43)39-29(46)25-4-2-14-40(25)30(47)23(33)16-18-5-9-20(10-6-18)41(48)49;2*1-2(3)4/h5-12,22-25,42H,1-4,13-17,32-33H2,(H,37,45)(H,38,44)(H4,34,35,36)(H,39,43,46);2*1H3,(H,3,4)/t22-,23-,24+,25-;;/m0../s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BW 443C
CAS:<p>BW 443C is a selective agonist of mu-opioid receptor.</p>Formula:C33H46N10O10Color and Shape:SolidMolecular weight:742.791
