
CAS 88334-75-2
:N-[3-(Diethylamino)propyl]methanesulfonamide
Description:
N-[3-(Diethylamino)propyl]methanesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a methanesulfonamide moiety attached to a propyl chain that is further substituted with a diethylamino group, contributing to its potential biological activity. The presence of the diethylamino group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry. The sulfonamide group also plays a crucial role in its interaction with biological targets, potentially influencing enzyme activity or receptor binding. This compound may exhibit properties such as moderate to high stability under standard conditions, and its synthesis typically involves the reaction of appropriate amines with sulfonyl chlorides. As with many sulfonamides, it may also exhibit a range of pharmacological effects, including antimicrobial activity, although specific biological activities would depend on the context of its use and formulation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H20N2O2S
InChI:InChI=1S/C8H20N2O2S/c1-4-10(5-2)8-6-7-9-13(3,11)12/h9H,4-8H2,1-3H3
InChI key:InChIKey=MHUJEGDLLFZVDD-UHFFFAOYSA-N
SMILES:N(CCCNS(C)(=O)=O)(CC)CC
Synonyms:- Methanesulfonamide, N-[3-(diethylamino)propyl]-
- N-[3-(Diethylamino)propyl]methanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
