CymitQuimica logo

CAS 88337-00-2

:

Methyl 4-iodobenzenepentadecanoate

Description:
Methyl 4-iodobenzenepentadecanoate, with the CAS number 88337-00-2, is an organic compound characterized by its ester functional group, which is formed from the reaction of a carboxylic acid and an alcohol. This compound features a methyl ester derived from pentadecanoic acid and a 4-iodobenzene moiety, indicating the presence of an iodine atom attached to the benzene ring at the para position. The structure suggests that it is a lipophilic molecule due to the long pentadecanoate chain, which contributes to its hydrophobic characteristics. Methyl 4-iodobenzenepentadecanoate may exhibit interesting chemical reactivity due to the presence of the iodine atom, which can participate in nucleophilic substitution reactions. Additionally, the compound's unique structure may impart specific physical properties, such as melting and boiling points, solubility in organic solvents, and potential applications in organic synthesis or as a reagent in various chemical reactions. However, detailed safety and handling information should be consulted, as with any chemical substance.
Formula:C22H35IO2
InChI:InChI=1S/C22H35IO2/c1-25-22(24)15-13-11-9-7-5-3-2-4-6-8-10-12-14-20-16-18-21(23)19-17-20/h16-19H,2-15H2,1H3
InChI key:InChIKey=BNGBPDHBXPNKEU-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCC(OC)=O)C1=CC=C(I)C=C1
Synonyms:
  • Methyl 4-iodobenzenepentadecanoate
  • Methyl 15-(4-Iodophenyl)pentadecanoate
  • Benzenepentadecanoic acid, 4-iodo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.