CAS 88339-44-0
:3-Acetyl-5-ethyl-2,4,6-trimethylbenzaldehyde
Description:
3-Acetyl-5-ethyl-2,4,6-trimethylbenzaldehyde, with the CAS number 88339-44-0, is an organic compound that belongs to the class of aromatic aldehydes. This substance features a benzene ring substituted with multiple alkyl groups, specifically three methyl groups, an ethyl group, and an acetyl group, alongside the aldehyde functional group. The presence of these substituents contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis and fragrance formulation. The compound is likely to exhibit a characteristic aromatic odor, typical of many aldehydes, and may be used in the production of flavoring agents or fragrances due to its pleasant scent. Additionally, its structure suggests that it may participate in various chemical reactions, such as nucleophilic addition or condensation reactions, making it a valuable intermediate in synthetic organic chemistry. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C14H18O2
InChI:InChI=1S/C14H18O2/c1-6-12-8(2)13(7-15)10(4)14(9(12)3)11(5)16/h7H,6H2,1-5H3
InChI key:InChIKey=SHILKZYUHOEHSB-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(C)C(CC)=C(C)C(C=O)=C1C
Synonyms:- 3-Acetyl-5-ethyl-2,4,6-trimethylbenzaldehyde
- Benzaldehyde, 3-acetyl-5-ethyl-2,4,6-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
