CymitQuimica logo

CAS 88342-13-6

:

N-[3-(acetylamino)phenyl]-2-chloroacetamide

Description:
N-[3-(acetylamino)phenyl]-2-chloroacetamide, with the CAS number 88342-13-6, is a chemical compound characterized by its specific functional groups and structural features. It contains an acetylamino group attached to a phenyl ring, which contributes to its potential biological activity. The presence of a chloroacetamide moiety suggests that it may exhibit reactivity typical of amides and halogenated compounds, potentially influencing its solubility and interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural similarity to other pharmacologically active molecules. Its molecular structure indicates that it could participate in hydrogen bonding, which is crucial for its interactions in biological systems. Additionally, the compound's properties, such as melting point, solubility, and stability, would be influenced by the presence of the chloro and acetyl groups. Overall, N-[3-(acetylamino)phenyl]-2-chloroacetamide represents a class of compounds that may have applications in drug development or as intermediates in organic synthesis.
Formula:C10H11ClN2O2
InChI:InChI=1/C10H11ClN2O2/c1-7(14)12-8-3-2-4-9(5-8)13-10(15)6-11/h2-5H,6H2,1H3,(H,12,14)(H,13,15)
SMILES:CC(=Nc1cccc(c1)N=C(CCl)O)O
Synonyms:
  • acetamide, N-[3-(acetylamino)phenyl]-2-chloro-
  • N-(3-Acetamidophenyl)-2-chloroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.