CAS 88343-72-0
:2-Chloroethyl 1-(methylsulfonyl)methanesulfonate
Description:
2-Chloroethyl 1-(methylsulfonyl)methanesulfonate, with the CAS number 88343-72-0, is a chemical compound characterized by its sulfonate functional groups and a chloroethyl moiety. It is typically a colorless to pale yellow liquid, exhibiting a moderate level of solubility in polar solvents such as water and alcohols, due to the presence of sulfonate groups. This compound is known for its reactivity, particularly in nucleophilic substitution reactions, making it useful in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its structure includes a chloroethyl group, which can act as a leaving group, facilitating further chemical transformations. Additionally, the presence of methylsulfonyl groups contributes to its polar nature and potential biological activity. Safety precautions are essential when handling this compound, as it may pose health risks, including irritation to skin and eyes, and potential toxicity. Proper storage and disposal methods should be followed to mitigate environmental impact.
Formula:C4H9ClO5S2
InChI:InChI=1/C4H9ClO5S2/c1-11(6,7)4-12(8,9)10-3-2-5/h2-4H2,1H3
InChI key:InChIKey=SEHSPJCWCBQHPF-UHFFFAOYSA-N
SMILES:C(S(OCCCl)(=O)=O)S(C)(=O)=O
Synonyms:- 2-Chloroethyl 1-(methylsulfonyl)methanesulfonate
- 2-Chloroethyl methanesulfonylmethanesulfonate
- 2-Chloroethyl methylsulfonylmethanesulfonate
- Chlorethyl SOSO
- Clomesone
- Methanesulfonic Acid, 1-(Methylsulfonyl)-, 2-Chloroethyl Ester
- Methanesulfonic acid, (methylsulfonyl)-, 2-chloroethyl ester
- NSC 338947
- 2-Chloroethyl (methylsulfonyl)methanesulfonate
- (Methylsulfonyl)methanesulfonic acid 2-chloroethyl ester
- SRI-6155
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Clomesone
CAS:<p>Clomesone, a synthetic drug, treats female infertility by blocking brain estrogen, inducing ovulation.</p>Formula:C4H9ClO5S2Purity:99%Color and Shape:SolidMolecular weight:236.692-Chloroethyl methanesulfonylmethanesulfonate
CAS:<p>2-Chloroethyl methanesulfonylmethanesulfonate (2CEMS) is a potent and selective inhibitor of the enzyme methyltransferase. This drug has been shown to be effective against leukemic mice, as well as against carcinoma cell lines in vitro. 2CEMS is also active in vivo, inhibiting the growth of bladder tumours in rats. The mechanism of action is not fully understood but may involve carbamoylation, which inhibits the production of fatty acids and nucleic acids. 2-Chloroethyl methanesulfonylmethanesulfonate has been shown to enhance antitumour activity when used in combination with specific antibodies.</p>Formula:C4H9ClO5S2Purity:Min. 95%Molecular weight:236.7 g/mol


