CAS 88343-73-1
:2-fluoroethyl (methylsulfonyl)methanesulfonate
Description:
2-Fluoroethyl (methylsulfonyl)methanesulfonate, with the CAS number 88343-73-1, is an organosulfur compound characterized by the presence of both sulfonate and fluorinated functional groups. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the sulfonate group, which serves as a good leaving group. The fluorine atom in the 2-fluoroethyl moiety enhances the compound's electrophilicity, making it useful in various synthetic applications, including the preparation of fluorinated compounds. Its solubility in polar organic solvents is notable, which facilitates its use in organic synthesis. Additionally, the compound's structure suggests potential applications in medicinal chemistry and agrochemicals, where fluorinated compounds often exhibit enhanced biological activity. However, handling precautions are necessary due to its potential toxicity and reactivity, emphasizing the importance of proper safety measures in laboratory settings.
Formula:C4H9FO5S2
InChI:InChI=1/C4H9FO5S2/c1-11(6,7)4-12(8,9)10-3-2-5/h2-4H2,1H3
SMILES:CS(=O)(=O)CS(=O)(=O)OCCF
Synonyms:- Methanesulfonic Acid, 1-(Methylsulfonyl)-, 2-Fluoroethyl Ester
- 2-Fluoroethyl (methylsulfonyl)methanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methanesulfonic acid,1-(methylsulfonyl)-, 2-fluoroethyl ester
CAS:Formula:C4H9FO5S2Molecular weight:220.2397
