CymitQuimica logo

CAS 88344-67-6

:

Benzenesulfonyl chloride, 2-chloro-3-nitro-4-phenoxy-

Description:
Benzenesulfonyl chloride, 2-chloro-3-nitro-4-phenoxy- is an organic compound characterized by the presence of a benzenesulfonyl chloride functional group, which is a sulfonic acid derivative where a chlorine atom replaces a hydroxyl group. This compound features a nitro group and a phenoxy group, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit a pale yellow to brown color. The presence of the chlorine and nitro groups indicates that it may participate in electrophilic aromatic substitution reactions, making it useful in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the compound is likely to be sensitive to moisture and should be handled with care, as benzenesulfonyl chlorides can release hydrochloric acid upon hydrolysis. Proper safety precautions, including the use of personal protective equipment, are essential when working with this substance due to its potential irritant properties.
Formula:C12H7Cl2NO5S
InChI:InChI=1S/C12H7Cl2NO5S/c13-11-10(21(14,18)19)7-6-9(12(11)15(16)17)20-8-4-2-1-3-5-8/h1-7H
InChI key:InChIKey=XSKWTEATMXSJBF-UHFFFAOYSA-N
SMILES:O(C1=C(N(=O)=O)C(Cl)=C(S(Cl)(=O)=O)C=C1)C2=CC=CC=C2
Synonyms:
  • Benzenesulfonyl chloride, 2-chloro-3-nitro-4-phenoxy-
  • 2-Chloro-3-nitro-4-phenoxybenzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.