CAS 88345-02-2

2-Chloro-3-nitro-4-phenoxy-N-(2-pyridinylmethyl)benzenesulfonamide

Description:

2-Chloro-3-nitro-4-phenoxy-N-(2-pyridinylmethyl)benzenesulfonamide is a synthetic organic compound characterized by its complex structure, which includes a sulfonamide group, a chloro substituent, a nitro group, and a phenoxy moiety. This compound features a pyridine ring, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the sulfonamide functional group suggests that it may exhibit antibacterial properties, as many sulfonamides are known for their antimicrobial effects. The nitro group can also play a role in the compound's reactivity and biological interactions. Additionally, the phenoxy group may enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Overall, the unique combination of functional groups in this compound suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through experimental studies.

Formula: C₁₈H₁₄ClN₃O₅S

InChI: InChI=1S/C18H14ClN3O5S/c19-17-16(28(25,26)21-12-13-6-4-5-11-20-13)10-9-15(18(17)22(23)24)27-14-7-2-1-3-8-14/h1-11,21H,12H2

InChI key: InChIKey=GOUIWLWEANGCHV-UHFFFAOYSA-N

SMILES: O(C1=C(N(=O)=O)C(Cl)=C(S(NCC2=CC=CC=N2)(=O)=O)C=C1)C3=CC=CC=C3

Synonyms:

• 2-Chloro-3-nitro-4-phenoxy-N-(2-pyridinylmethyl)benzenesulfonamide
• Benzenesulfonamide, 2-chloro-3-nitro-4-phenoxy-N-(2-pyridinylmethyl)-

Benzenesulfonamide, 2-chloro-3-nitro-4-phenoxy-N-(2-pyridinylmethyl)-

CAS: 88345-02-2

Formula: C₁₈H₁₄ClN₃O₅S

Molecular weight: 419.8389

Ref: IN-DA0047QD