CAS 88345-91-9
:5-Bromo-2-(4-methoxyphenyl)-4-phenylpyridine
Description:
5-Bromo-2-(4-methoxyphenyl)-4-phenylpyridine is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and two phenyl groups, one of which is further substituted with a methoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural features. The presence of the bromine atom can enhance its reactivity and influence its interaction with biological targets. The methoxy group may also contribute to its solubility and stability in various solvents. In terms of applications, compounds like this are often investigated for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C18H14BrNO
InChI:InChI=1S/C18H14BrNO/c1-21-15-9-7-14(8-10-15)18-11-16(17(19)12-20-18)13-5-3-2-4-6-13/h2-12H,1H3
InChI key:InChIKey=SBHSEEKIISGGJO-UHFFFAOYSA-N
SMILES:BrC1=C(C=C(N=C1)C2=CC=C(OC)C=C2)C3=CC=CC=C3
Synonyms:- 5-Bromo-2-(4-methoxyphenyl)-4-phenylpyridine
- Pyridine, 5-bromo-2-(4-methoxyphenyl)-4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
