CAS 88345-94-2

5-Bromo-2-(2-methylphenyl)pyridine

Description:

5-Bromo-2-(2-methylphenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a 2-methylphenyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block in organic synthesis. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the presence of the methylphenyl group can influence the compound's solubility and stability. As with many brominated compounds, it is important to handle 5-Bromo-2-(2-methylphenyl)pyridine with care, as brominated organic compounds can exhibit toxicity and environmental persistence. Proper safety measures should be taken when working with this substance in laboratory settings.

Formula: C₁₂H₁₀BrN

InChI: InChI=1S/C12H10BrN/c1-9-4-2-3-5-11(9)12-7-6-10(13)8-14-12/h2-8H,1H3

InChI key: InChIKey=QKYDTWSRQURVQZ-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC=C(Br)C=N2)C=CC=C1

Synonyms:

• 5-Bromo-2-(2-methylphenyl)pyridine
• Pyridine, 5-bromo-2-(2-methylphenyl)-