CAS 88347-36-8

1-methyl-2-oxo-5,6,7,8-tetrahydroquinoline-3-carboxylic acid

Description:

1-Methyl-2-oxo-5,6,7,8-tetrahydroquinoline-3-carboxylic acid, with the CAS number 88347-36-8, is a heterocyclic compound characterized by its quinoline structure, which includes a fused bicyclic system. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the methyl and carbonyl groups enhances its chemical properties, making it a subject of interest in medicinal chemistry and organic synthesis. Typically, compounds of this nature exhibit moderate to high solubility in polar solvents due to the carboxylic acid group, while their hydrophobic regions may influence interactions with biological systems. Additionally, the tetrahydroquinoline framework suggests potential biological activity, which may include antimicrobial or anti-inflammatory properties. The compound's unique structure allows for various modifications, making it a valuable intermediate in the synthesis of more complex molecules. Overall, 1-methyl-2-oxo-5,6,7,8-tetrahydroquinoline-3-carboxylic acid is notable for its structural features and potential applications in pharmaceuticals and organic chemistry.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-12-9-5-3-2-4-7(9)6-8(10(12)13)11(14)15/h6H,2-5H2,1H3,(H,14,15)

SMILES: Cn1c2CCCCc2cc(c1=O)C(=O)O

1-Methyl-2-oxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxylic acid

CAS: 88347-36-8

Formula: C₁₁H₁₃NO₃

Molecular weight: 207.2258

Ref: IN-DA0046F1