CAS 883499-24-9
:1-Bromo-2-chloro-3-fluorobenzene
Description:
1-Bromo-2-chloro-3-fluorobenzene is an aromatic halogenated compound characterized by the presence of three different halogen substituents on a benzene ring. The compound features a bromine atom, a chlorine atom, and a fluorine atom attached to the second, third, and first positions of the benzene ring, respectively. This unique arrangement contributes to its chemical reactivity and physical properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of multiple halogens can influence its polarity, making it more soluble in organic solvents than in water. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the compound's halogen substituents can impart specific characteristics such as increased stability and altered electronic properties, which are valuable in various chemical applications. Safety precautions should be taken when handling this compound, as halogenated aromatic compounds can be toxic and environmentally persistent.
Formula:C6H3BrClF
InChI:InChI=1/C6H3BrClF/c7-4-2-1-3-5(9)6(4)8/h1-3H
SMILES:c1cc(c(c(c1)F)Cl)Br
Synonyms:- Benzene, 1-bromo-2-chloro-3-fluoro-
- 2-Chloro-3-fluorobromobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Bromo-2-chloro-3-fluorobenzene
CAS:Formula:C6H3BrClFPurity:98%Color and Shape:SolidMolecular weight:209.44342-Chloro-3-fluorobromobenzene
CAS:2-Chloro-3-fluorobromobenzeneFormula:C6H3BrClFPurity:≥95%Color and Shape: faint yellow. low melting solidMolecular weight:209.44g/mol1-Bromo-2-chloro-3-fluorobenzene
CAS:Formula:C6H3BrClFPurity:>98.0%(GC)Color and Shape:White or Colorless to Almost white or Almost colorless powder to lump to clear liquidMolecular weight:209.441-Bromo-2-chloro-3-fluorobenzene
CAS:Formula:C6H3BrClFPurity:98.0%Color and Shape:Solid, Low Melting SolidMolecular weight:209.441-Bromo-2-chloro-3-fluorobenzene
CAS:1-Bromo-2-chloro-3-fluorobenzene is a halide of fluorine and chlorine. It is used in the production of biphenyls and fluoroarenes. 1-Bromo-2-chloro-3-fluorobenzene has anticarcinogenic properties in animal studies, but it can be toxic to humans. Exposure to 1-bromo-2,3 difluorobenzene may lead to neurological, respiratory, hepatic, ocular, and gastrointestinal toxicity. This compound also has been shown to affect the liver enzymes as an enzyme inducer and is believed to be carcinogenic in animals.
Formula:C6H3BrClFPurity:Min. 95%Color and Shape:PowderMolecular weight:209.44 g/mol




