CAS 883500-51-4

4-chloro-3-fluorophenylacetic acid

Description:

4-Chloro-3-fluorophenylacetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both a chlorine and a fluorine atom, as well as a carboxylic acid functional group. The presence of the chlorine and fluorine atoms contributes to its unique chemical reactivity and potential applications in pharmaceuticals and agrochemicals. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, while the halogen substituents can influence its lipophilicity and biological activity. The molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may undergo typical reactions associated with carboxylic acids, such as esterification and acid-base reactions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-chloro-3-fluorophenylacetic acid is a versatile compound with significant implications in various chemical research fields.

Formula: C₈H₆ClFO₂

InChI: InChI=1S/C8H6ClFO2/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3H,4H2,(H,11,12)

SMILES: c1cc(c(cc1CC(=O)O)F)Cl

Synonyms:

• 4-Chloro-3-Fluorophenylaceticacid
• Phenol,4-chloro-3-fluoro-, acetate
• 4-Chloro-3-fluorophenylacetate

4-Chloro-3-fluorophenylacetic acid

CAS: 883500-51-4

Formula: C₈H₆ClFO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.5834

Ref: IN-DA00GSEH

4-Chloro-3-fluorophenylacetic acid

CAS: 883500-51-4

4-Chloro-3-fluorophenylacetic acid

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 188.58g/mol

Ref: 54-PC9429

4-Chloro-3-fluorophenylacetic acid

CAS: 883500-51-4

4-Chloro-3-fluorophenylacetic acid is a high quality reagent that is used as a complex compound. It has CAS No. 883500-51-4, and it is useful in the manufacture of fine chemicals, speciality chemicals, research chemicals, and versatile building blocks. The chemical can be used as a reaction component for the production of various compounds with different molecular structures.

Formula: C₈H₆ClFO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 188.58 g/mol

Ref: 3D-FC63966

4-Chloro-3-fluorophenylacetic acid

CAS: 883500-51-4

Formula: C₈H₆ClFO₂

Purity: 97%

Color and Shape: Solid, White powder

Molecular weight: 188.58

Ref: 10-F092867