CAS 883500-73-0

5-bromo-7-fluoro-1H-indole

Description:

5-Bromo-7-fluoro-1H-indole is a heterocyclic organic compound that belongs to the indole family, characterized by a fused benzene and pyrrole ring structure. This compound features a bromine atom at the 5-position and a fluorine atom at the 7-position of the indole ring, which can influence its chemical reactivity and biological activity. The presence of these halogen substituents often enhances the compound's lipophilicity and can affect its interactions with biological targets, making it of interest in medicinal chemistry and drug development. 5-Bromo-7-fluoro-1H-indole may exhibit various properties such as fluorescence, which can be useful in imaging applications. Additionally, its structural features may contribute to its potential as a scaffold for the synthesis of more complex molecules. As with many indole derivatives, it may also display a range of biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Proper handling and safety measures should be observed due to the presence of halogens, which can pose health risks.

Formula: C₈H₅BrFN

InChI: InChI=1/C8H5BrFN/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H

SMILES: c1c[nH]c2c1cc(cc2F)Br

Synonyms:

• 1H-indole, 5-bromo-7-fluoro-
• 5-Bromo-7-fluoro-1H-indole

5-Bromo-7-fluoro-1H-indole

CAS: 883500-73-0

Formula: C₈H₅BrFN

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.0344

Ref: IN-DA003MJT

5-Bromo-7-fluoro-1H-indole

CAS: 883500-73-0

5-Bromo-7-fluoro-1H-indole

Purity: 95%

Color and Shape: Yellow Liquid

Molecular weight: 214.03g/mol

Ref: 54-PC6967

5-Bromo-7-fluoro-1H-indole

CAS: 883500-73-0

Formula: C₈H₅BrFN

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.037

Ref: 10-F321543