CAS 883500-96-7
:6-bromo-2-ethenylquinazolin-4(1H)-one
Description:
6-Bromo-2-ethenylquinazolin-4(1H)-one is a synthetic organic compound characterized by its quinazolinone structure, which features a bromine atom at the 6-position and an ethenyl group at the 2-position of the quinazoline ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many quinazolinone derivatives. The presence of the bromine atom can influence its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as brominated compounds often exhibit unique biological activities. The ethenyl group may also enhance its reactivity, making it a potential candidate for further chemical modifications. Additionally, the compound may display fluorescence properties, which can be useful in various analytical applications. Overall, 6-bromo-2-ethenylquinazolin-4(1H)-one represents a versatile scaffold for research in drug discovery and material science.
Formula:C10H7BrN2O
InChI:InChI=1/C10H7BrN2O/c1-2-9-12-8-4-3-6(11)5-7(8)10(14)13-9/h2-5H,1H2,(H,12,13,14)
SMILES:C=Cc1nc2ccc(cc2c(n1)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
