CAS 883502-07-6
:(2-Bromo-4,5-difluorophenyl)acetic acid
Description:
(2-Bromo-4,5-difluorophenyl)acetic acid is an organic compound characterized by its aromatic structure and the presence of halogen substituents. It features a phenyl ring with a bromine atom at the 2-position and two fluorine atoms at the 4 and 5 positions, along with an acetic acid functional group. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic aromatic nature. The presence of the bromine and fluorine atoms contributes to its unique reactivity and potential applications in pharmaceuticals and agrochemicals. The carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound's structure may influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, (2-Bromo-4,5-difluorophenyl)acetic acid is a versatile compound with significant implications in chemical research and development.
Formula:C8H5BrF2O2
InChI:InChI=1/C8H5BrF2O2/c9-5-3-7(11)6(10)1-4(5)2-8(12)13/h1,3H,2H2,(H,12,13)
SMILES:c1c(CC(=O)O)c(cc(c1F)F)Br
Synonyms:- 2-Bromo-4,5-difluorophenylacetic acid
- Benzeneacetic Acid, 2-Bromo-4,5-Difluoro-
- Qv1R Cf Df Fe
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-4,5-difluorophenylacetic acid, 98%
CAS:2-Bromo-4,5-difluorophenylacetic acid is used as intermediate in organic syntheses. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item cFormula:C8H5BrF2O2Purity:98%Molecular weight:251.032-(2-Bromo-4,5-difluorophenyl)acetic acid
CAS:Formula:C8H5BrF2O2Purity:97%Color and Shape:SolidMolecular weight:251.02492-Bromo-4,5-difluorophenylacetic acid
CAS:2-Bromo-4,5-difluorophenylacetic acidFormula:C8H5BrF2O2Purity:98%Color and Shape: white crystalline powderMolecular weight:251.02g/mol2-(2-Bromo-4,5-difluorophenyl)acetic acid
CAS:Formula:C8H5BrF2O2Purity:97%Color and Shape:SolidMolecular weight:251.027



