CAS 88351-77-3
:ethyl 4-[(3-{[(2-oxo-1,3-benzoxazol-3(2H)-yl)methyl]amino}benzoyl)amino]benzoate hydrate (1:1)
Description:
Ethyl 4-[(3-{[(2-oxo-1,3-benzoxazol-3(2H)-yl)methyl]amino}benzoyl)amino]benzoate hydrate (1:1), with CAS number 88351-77-3, is a complex organic compound characterized by its multi-functional structure, which includes both ester and amide linkages. This compound features a benzoxazole moiety, which is known for its biological activity, particularly in medicinal chemistry. The presence of the ethyl ester group suggests potential solubility in organic solvents, while the hydrate form indicates that it can associate with water molecules, affecting its stability and reactivity. The compound may exhibit properties such as fluorescence due to the benzoxazole ring, and it could be of interest in pharmaceutical applications, particularly in drug design and development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to elucidate its pharmacological potential. Overall, this compound represents a significant example of the intersection between organic synthesis and medicinal chemistry.
Formula:C24H23N3O6
InChI:InChI=1/C24H21N3O5.H2O/c1-2-31-23(29)16-10-12-18(13-11-16)26-22(28)17-6-5-7-19(14-17)25-15-27-20-8-3-4-9-21(20)32-24(27)30;/h3-14,25H,2,15H2,1H3,(H,26,28);1H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ETHYL 4-[[3-[(2-OXOBENZOOXAZOL-3-YL)METHYLAMINO]BENZOYL]AMINO]BENZOATE HYDRATE
CAS:Formula:C24H23N3O6Molecular weight:449.4559
