CAS 883514-21-4
:(5-bromo-2-fluorophenyl)acetic acid
Description:
(5-Bromo-2-fluorophenyl)acetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as a carboxylic acid functional group. The presence of the bromine and fluorine substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents like water and alcohols due to the carboxylic acid group. It may exhibit biological activity, making it of interest in pharmaceutical research and development. The bromine and fluorine atoms can enhance the lipophilicity and metabolic stability of potential drug candidates. Additionally, (5-bromo-2-fluorophenyl)acetic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C8H6BrFO2
InChI:InChI=1/C8H6BrFO2/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3H,4H2,(H,11,12)
SMILES:c1cc(c(cc1Br)CC(=O)O)F
Synonyms:- 2-(5-Bromo-2-Fluorophenyl)Acetic Acid
- Benzeneacetic Acid, 5-Bromo-2-Fluoro-
- 2-Fluoro-5-Bromophenylacetic Acid
- 5-Bromo-2-fluorophenylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-2-fluorophenylacetic acid
CAS:Formula:C8H6BrFO2Purity:97%Color and Shape:SolidMolecular weight:233.03445-Bromo-2-fluorophenylacetic acid
CAS:5-Bromo-2-fluorophenylacetic acidPurity:98%Molecular weight:233.03g/mol5-Bromo-2-fluorophenylacetic acid
CAS:Formula:C8H6BrFO2Purity:98.0%Color and Shape:SolidMolecular weight:233.0365-Bromo-2-fluorophenylacetic acid
CAS:Please enquire for more information about 5-Bromo-2-fluorophenylacetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H6BrFO2Purity:Min. 95%Molecular weight:233.03 g/mol



