CAS 88352-44-7
:ethyl [2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]acetate
Description:
Ethyl [2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]acetate is a chemical compound characterized by its complex structure, which includes an oxazole ring, a furan moiety, and an ethyl acetate functional group. The presence of the 4-chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit unique pharmacological properties. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular interactions. It may exhibit moderate to high lipophilicity due to the aromatic and furan components, influencing its solubility in organic solvents. The oxazole ring suggests potential reactivity, particularly in nucleophilic substitution or electrophilic aromatic substitution reactions. Additionally, the compound may possess interesting optical properties, making it a candidate for various applications in pharmaceuticals, agrochemicals, or materials science. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C17H14ClNO4
InChI:InChI=1/C17H14ClNO4/c1-2-21-15(20)10-13-16(14-4-3-9-22-14)23-17(19-13)11-5-7-12(18)8-6-11/h3-9H,2,10H2,1H3
SMILES:CCOC(=O)Cc1c(c2ccco2)oc(c2ccc(cc2)Cl)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 2-(4-chlorophenyl)-5-(2-furyl)oxazole-4-acetate
CAS:<p>Ethyl 2-(4-chlorophenyl)-5-(2-furyl)oxazole-4-acetate is an ester of a human metabolite. It is an inhibitor of platelet aggregation and has been shown to be a potent inhibitor of the cytochrome P450 enzyme system. This drug has also been shown to inhibit the production of thromboxane in vitro studies, but not in vivo. The inhibition of platelet aggregation by this compound may be due to its ability to dehydrate blood platelets. The drug has also been shown to have antiplatelet activity in humans and animals.</p>Formula:C17H14ClNO4Purity:Min. 95%Molecular weight:331.7 g/molTA-1801
CAS:TA-1801 is an agent of hypolipidemic.Formula:C17H14ClNO4Purity:98%Color and Shape:SolidMolecular weight:331.75

