CAS 88352-87-8

4-Chloro-N-[2-(2-furanyl)-2-oxoethyl]benzamide

Description:

4-Chloro-N-[2-(2-furanyl)-2-oxoethyl]benzamide, with the CAS number 88352-87-8, is an organic compound characterized by its complex structure that includes a benzamide moiety and a furan ring. The presence of the chloro substituent on the benzene ring enhances its reactivity and may influence its biological activity. The furan ring contributes to the compound's potential as a pharmacophore, which can interact with biological targets. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic and heterocyclic components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with furan and amide functionalities are often associated with various biological activities. Additionally, the compound's stability and reactivity can be influenced by the presence of the chloro group, which may participate in electrophilic substitution reactions. Overall, 4-Chloro-N-[2-(2-furanyl)-2-oxoethyl]benzamide represents a class of compounds that may be of interest for further research in drug development and synthetic chemistry.

Formula: C₁₃H₁₀ClNO₃

InChI: InChI=1S/C13H10ClNO3/c14-10-5-3-9(4-6-10)13(17)15-8-11(16)12-2-1-7-18-12/h1-7H,8H2,(H,15,17)

InChI key: InChIKey=HFMJQEZNSGZLMO-UHFFFAOYSA-N

SMILES: C(NCC(=O)C1=CC=CO1)(=O)C2=CC=C(Cl)C=C2

Synonyms:

• Benzamide, 4-chloro-N-[2-(2-furanyl)-2-oxoethyl]-
• 4-Chloro-N-[2-(2-furanyl)-2-oxoethyl]benzamide

Benzamide, 4-chloro-N-[2-(2-furanyl)-2-oxoethyl]-

CAS: 88352-87-8

Formula: C₁₃H₁₀ClNO₃

Molecular weight: 263.6764

Ref: IN-DA0045AP